C9H17N3S — CID 163924537
4-amino-3,4-dimethyl-1-propan-2-ylpyrimidine-2-thione (PubChem CID 163924537) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 4-amino-3,4-dimethyl-1-propan-2-ylpyrimidine-2-thione.
| Compound Name | 4-amino-3,4-dimethyl-1-propan-2-ylpyrimidine-2-thione |
|---|---|
| PubChem CID | 163924537 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-amino-3,4-dimethyl-1-propan-2-ylpyrimidine-2-thione |
| SMILES | CC(C)N1C=CC(C)(N)N(C)C1=S |
| InChI | InChI=1S/C9H17N3S/c1-7(2)12-6-5-9(3,10)11(4)8(12)13/h5-7H,10H2,1-4H3 |
| InChIKey | RDHNGCIEJTTWHE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|