C9H17ClN2S — CID 87882217
1,3-diethyl-4-methyl-1,4-dihydropyrimidin-1-ium-2-thione chloride (PubChem CID 87882217) has the molecular formula C9H17ClN2S and a molecular weight of 220.77 g/mol. Its IUPAC name is 1,3-diethyl-4-methyl-1,4-dihydropyrimidin-1-ium-2-thione chloride.
| Compound Name | 1,3-diethyl-4-methyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
|---|---|
| PubChem CID | 87882217 |
| Molecular Formula | C9H17ClN2S |
| Molecular Weight | 220.77 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,3-diethyl-4-methyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
| SMILES | CCN1C(=S)[NH+](CC)C=CC1C.[Cl-] |
| InChI | InChI=1S/C9H16N2S.ClH/c1-4-10-7-6-8(3)11(5-2)9(10)12;/h6-8H,4-5H2,1-3H3;1H |
| InChIKey | HOWGUXDCTLJQAV-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.77 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|