C7H13ClN2S — CID 87882202
1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride (PubChem CID 87882202) has the molecular formula C7H13ClN2S and a molecular weight of 192.72 g/mol. Its IUPAC name is 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride.
| Compound Name | 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
|---|---|
| PubChem CID | 87882202 |
| Molecular Formula | C7H13ClN2S |
| Molecular Weight | 192.72 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-thione chloride |
| SMILES | CC1C=C[NH+](C)C(=S)N1C.[Cl-] |
| InChI | InChI=1S/C7H12N2S.ClH/c1-6-4-5-8(2)7(10)9(6)3;/h4-6H,1-3H3;1H |
| InChIKey | XCWPPOFKBPOMOM-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.72 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|