C6H8N2 — CID 134613103
6,8-diazabicyclo[3.2.1]octa-1,3-diene (PubChem CID 134613103) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is 6,8-diazabicyclo[3.2.1]octa-1,3-diene.
| Compound Name | 6,8-diazabicyclo[3.2.1]octa-1,3-diene |
|---|---|
| PubChem CID | 134613103 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 6,8-diazabicyclo[3.2.1]octa-1,3-diene |
| SMILES | C1=CC2NCC(=C1)N2 |
| InChI | InChI=1S/C6H8N2/c1-2-5-4-7-6(3-1)8-5/h1-3,6-8H,4H2 |
| InChIKey | BALJAFYSDGIQLV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |