About 6,8-diazabicyclo[3.2.1]octa-1,3-diene
6,8-diazabicyclo[3.2.1]octa-1,3-diene (PubChem CID 134613103) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 6,8-diazabicyclo[3.2.1]octa-1,3-diene.
Molecular Properties
| Compound Name | 6,8-diazabicyclo[3.2.1]octa-1,3-diene |
| PubChem CID | 134613103 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 6,8-diazabicyclo[3.2.1]octa-1,3-diene |
| SMILES | C1=CC2NCC(=C1)N2 |
| InChI | InChI=1S/C6H8N2/c1-2-5-4-7-6(3-1)8-5/h1-3,6-8H,4H2 |
| InChIKey | BALJAFYSDGIQLV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-diazabicyclo[3.2.1]octa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-diazabicyclo[3.2.1]octa-1,3-diene?
The IUPAC name of 6,8-diazabicyclo[3.2.1]octa-1,3-diene (CID 134613103) is 6,8-diazabicyclo[3.2.1]octa-1,3-diene.
What is the SMILES notation for 6,8-diazabicyclo[3.2.1]octa-1,3-diene?
The canonical SMILES for 6,8-diazabicyclo[3.2.1]octa-1,3-diene is C1=CC2NCC(=C1)N2.
What is the InChIKey of 6,8-diazabicyclo[3.2.1]octa-1,3-diene?
The InChIKey is BALJAFYSDGIQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-2-5-4-7-6(3-1)8-5/h1-3,6-8H,4H2.
What are the key properties of 6,8-diazabicyclo[3.2.1]octa-1,3-diene?
6,8-diazabicyclo[3.2.1]octa-1,3-diene has a molecular weight of 108.14 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-diazabicyclo[3.2.1]octa-1,3-diene is sourced from PubChem (CID 134613103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).