C8H3F6IO — CID 134639186
4-iodo-3,5-bis(trifluoromethyl)phenol (PubChem CID 134639186) has the molecular formula C8H3F6IO and a molecular weight of 356.00 g/mol. Its IUPAC name is 4-iodo-3,5-bis(trifluoromethyl)phenol.
| Compound Name | 4-iodo-3,5-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 134639186 |
| Molecular Formula | C8H3F6IO |
| Molecular Weight | 356.00 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 4-iodo-3,5-bis(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)c(I)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H3F6IO/c9-7(10,11)4-1-3(16)2-5(6(4)15)8(12,13)14/h1-2,16H |
| InChIKey | YBQRRXZSSPJLCR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.00 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|