C10H7ClO3 — CID 13464714
2-chloro-4-methylbenzene-1,3,5-tricarbaldehyde (PubChem CID 13464714) has the molecular formula C10H7ClO3 and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-chloro-4-methylbenzene-1,3,5-tricarbaldehyde.
| Compound Name | 2-chloro-4-methylbenzene-1,3,5-tricarbaldehyde |
|---|---|
| PubChem CID | 13464714 |
| Molecular Formula | C10H7ClO3 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-chloro-4-methylbenzene-1,3,5-tricarbaldehyde |
| SMILES | Cc1c(C=O)cc(C=O)c(Cl)c1C=O |
| InChI | InChI=1S/C10H7ClO3/c1-6-7(3-12)2-8(4-13)10(11)9(6)5-14/h2-5H,1H3 |
| InChIKey | RLSMXGXRMIXJHR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|