C8H4ClF6NO — CID 134659693
2-(chloromethyl)-6-(difluoromethyl)-4-fluoro-3-(trifluoromethoxy)pyridine (PubChem CID 134659693) has the molecular formula C8H4ClF6NO and a molecular weight of 279.57 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(difluoromethyl)-4-fluoro-3-(trifluoromethoxy)pyridine.
| Compound Name | 2-(chloromethyl)-6-(difluoromethyl)-4-fluoro-3-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 134659693 |
| Molecular Formula | C8H4ClF6NO |
| Molecular Weight | 279.57 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 2-(chloromethyl)-6-(difluoromethyl)-4-fluoro-3-(trifluoromethoxy)pyridine |
| SMILES | Fc1cc(C(F)F)nc(CCl)c1OC(F)(F)F |
| InChI | InChI=1S/C8H4ClF6NO/c9-2-5-6(17-8(13,14)15)3(10)1-4(16-5)7(11)12/h1,7H,2H2 |
| InChIKey | QVTMQJUGXCCZPQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|