C18H18Cl2N4O — CID 134686742
(2,3-dichloro-4-pyridinyl)-(3-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl)methanone (PubChem CID 134686742) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is (2,3-dichloro-4-pyridinyl)-(3-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl)methanone.
| Compound Name | (2,3-dichloro-4-pyridinyl)-(3-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 134686742 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2,3-dichloro-4-pyridinyl)-(3-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrazolo[3,4-c]pyridin-6-yl)methanone |
| SMILES | O=C(c1ccnc(Cl)c1Cl)N1CCC2C(C1)NNC2c1ccccc1 |
| InChI | InChI=1S/C18H18Cl2N4O/c19-15-13(6-8-21-17(15)20)18(25)24-9-7-12-14(10-24)22-23-16(12)11-4-2-1-3-5-11/h1-6,8,12,14,16,22-23H,7,9-10H2 |
| InChIKey | ANWIUNFGGNAICG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|