C22H26N2O3S — CID 134698795
[(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(phenylsulfanylmethyl)furan-2-yl]methanone (PubChem CID 134698795) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(phenylsulfanylmethyl)furan-2-yl]methanone.
| Compound Name | [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(phenylsulfanylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 134698795 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(phenylsulfanylmethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(CSc2ccccc2)o1)N1CCN2[C@@H](COC[C@@H]2C2CC2)C1 |
| InChI | InChI=1S/C22H26N2O3S/c25-22(21-9-8-18(27-21)15-28-19-4-2-1-3-5-19)23-10-11-24-17(12-23)13-26-14-20(24)16-6-7-16/h1-5,8-9,16-17,20H,6-7,10-15H2/t17-,20-/m1/s1 |
| InChIKey | QYCVRQCVDIUOJX-YLJYHZDGSA-N |
| XLogP | 3.51 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |