C23H30N4O2 — CID 134700607
N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-methylbenzamide (PubChem CID 134700607) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-methylbenzamide.
| Compound Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 134700607 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-N-methylbenzamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)c3ccc(-c4noc(C5CC5)n4)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C23H30N4O2/c1-26(2)19-10-17-12-20(13-18(17)11-19)27(3)23(28)16-8-4-14(5-9-16)21-24-22(29-25-21)15-6-7-15/h4-5,8-9,15,17-20H,6-7,10-13H2,1-3H3/t17-,18+,19?,20? |
| InChIKey | AWBOIEIBBDREON-VCWRXUFXSA-N |
| XLogP | 3.80 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |