C22H34N2O2 — CID 134701568
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,2-dimethyl-2-(4-methylphenoxy)propanamide (PubChem CID 134701568) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,2-dimethyl-2-(4-methylphenoxy)propanamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,2-dimethyl-2-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 134701568 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,2-dimethyl-2-(4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OC(C)(C)C(=O)N(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H34N2O2/c1-15-7-9-20(10-8-15)26-22(2,3)21(25)24(6)19-13-16-11-18(23(4)5)12-17(16)14-19/h7-10,16-19H,11-14H2,1-6H3/t16-,17+,18?,19? |
| InChIKey | DBBIQYCTFCRRJN-LPOKXYRGSA-N |
| XLogP | 3.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |