C17H22FN3O — CID 134702201
N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-fluorophenyl)butanamide (PubChem CID 134702201) has the molecular formula C17H22FN3O and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-fluorophenyl)butanamide.
| Compound Name | N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 134702201 |
| Molecular Formula | C17H22FN3O |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-4-(4-fluorophenyl)butanamide |
| SMILES | CCc1c(C)nn(C)c1NC(=O)CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN3O/c1-4-15-12(2)20-21(3)17(15)19-16(22)7-5-6-13-8-10-14(18)11-9-13/h8-11H,4-7H2,1-3H3,(H,19,22) |
| InChIKey | MMCWRJFGERTJGO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |