C15H16F3N3O — CID 134712047
N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-2-(3,4,5-trifluorophenyl)acetamide (PubChem CID 134712047) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-2-(3,4,5-trifluorophenyl)acetamide.
| Compound Name | N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-2-(3,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 134712047 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(4-ethyl-1,3-dimethylpyrazol-5-yl)-2-(3,4,5-trifluorophenyl)acetamide |
| SMILES | CCc1c(C)nn(C)c1NC(=O)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H16F3N3O/c1-4-10-8(2)20-21(3)15(10)19-13(22)7-9-5-11(16)14(18)12(17)6-9/h5-6H,4,7H2,1-3H3,(H,19,22) |
| InChIKey | URIPPIUBMZAQTF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|