C18H25N3O2 — CID 134709520
4,6-dimethoxy-N-(4-methyl-4-phenylpentan-2-yl)pyrimidin-2-amine (PubChem CID 134709520) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(4-methyl-4-phenylpentan-2-yl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(4-methyl-4-phenylpentan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 134709520 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4,6-dimethoxy-N-(4-methyl-4-phenylpentan-2-yl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NC(C)CC(C)(C)c2ccccc2)n1 |
| InChI | InChI=1S/C18H25N3O2/c1-13(12-18(2,3)14-9-7-6-8-10-14)19-17-20-15(22-4)11-16(21-17)23-5/h6-11,13H,12H2,1-5H3,(H,19,20,21) |
| InChIKey | LSSJLLZSJZDDSG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |