C18H16ClNO4S2 — CID 134716420
5-[(E)-2-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione (PubChem CID 134716420) has the molecular formula C18H16ClNO4S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 5-[(E)-2-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione.
| Compound Name | 5-[(E)-2-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 134716420 |
| Molecular Formula | C18H16ClNO4S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 5-[(E)-2-(4-chlorophenyl)ethenyl]-3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione |
| SMILES | COc1ccc(S(=O)(=O)N2CC(/C=C/c3ccc(Cl)cc3)OC2=S)cc1 |
| InChI | InChI=1S/C18H16ClNO4S2/c1-23-15-8-10-17(11-9-15)26(21,22)20-12-16(24-18(20)25)7-4-13-2-5-14(19)6-3-13/h2-11,16H,12H2,1H3/b7-4+ |
| InChIKey | SXJNTNDKXCRQOB-QPJJXVBHSA-N |
| XLogP | 3.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|