C24H21NO4S2 — CID 134716508
5-[(E)-2-phenylethenyl]-3-(4-phenylmethoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione (PubChem CID 134716508) has the molecular formula C24H21NO4S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 5-[(E)-2-phenylethenyl]-3-(4-phenylmethoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione.
| Compound Name | 5-[(E)-2-phenylethenyl]-3-(4-phenylmethoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 134716508 |
| Molecular Formula | C24H21NO4S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 5-[(E)-2-phenylethenyl]-3-(4-phenylmethoxyphenyl)sulfonyl-1,3-oxazolidine-2-thione |
| SMILES | O=S(=O)(c1ccc(OCc2ccccc2)cc1)N1CC(/C=C/c2ccccc2)OC1=S |
| InChI | InChI=1S/C24H21NO4S2/c26-31(27,23-15-13-21(14-16-23)28-18-20-9-5-2-6-10-20)25-17-22(29-24(25)30)12-11-19-7-3-1-4-8-19/h1-16,22H,17-18H2/b12-11+ |
| InChIKey | GEAWECDIXZQEPH-VAWYXSNFSA-N |
| XLogP | 4.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|