C44H82NO9P — CID 134717579
[2-[(9Z,11E)-13-hydroxyoctadeca-9,11-dienoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134717579) has the molecular formula C44H82NO9P and a molecular weight of 800.11 g/mol. Its IUPAC name is [2-[(9Z,11E)-13-hydroxyoctadeca-9,11-dienoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(9Z,11E)-13-hydroxyoctadeca-9,11-dienoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134717579 |
| Molecular Formula | C44H82NO9P |
| Molecular Weight | 800.11 g/mol |
| Exact Mass | 799.57 |
| IUPAC Name | [2-[(9Z,11E)-13-hydroxyoctadeca-9,11-dienoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C=C\C(O)CCCCC |
| InChI | InChI=1S/C44H82NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-21-24-27-31-35-43(47)51-39-42(40-53-55(49,50)52-38-37-45(3,4)5)54-44(48)36-32-28-25-22-19-20-23-26-30-34-41(46)33-29-9-7-2/h15-16,23,26,30,34,41-42,46H,6-14,17-22,24-25,27-29,31-33,35-40H2,1-5H3/b16-15-,26-23-,34-30+ |
| InChIKey | ABWPOKQHWOIUCV-XMRKMLFISA-N |
| XLogP | 10.47 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.11 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|