C35H63NO8P+ — CID 134720543
2-[[2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(E)-undec-4-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134720543) has the molecular formula C35H63NO8P+ and a molecular weight of 656.86 g/mol. Its IUPAC name is 2-[[2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(E)-undec-4-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(E)-undec-4-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134720543 |
| Molecular Formula | C35H63NO8P+ |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.43 |
| IUPAC Name | 2-[[2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(E)-undec-4-enoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COC(=O)CC/C=C/CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C35H62NO8P/c1-6-8-10-12-14-16-17-18-19-20-22-24-26-28-35(38)44-33(32-43-45(39,40)42-30-29-36(3,4)5)31-41-34(37)27-25-23-21-15-13-11-9-7-2/h8,10,12,14,16-17,21,23,33H,6-7,9,11,13,15,18-20,22,24-32H2,1-5H3/p+1/b10-8+,14-12+,17-16+,23-21+ |
| InChIKey | BDOBCIZQBUXOMY-XYXBRACCSA-O |
| XLogP | 8.40 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|