C34H58O4 — CID 134725920
9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexadecanoic acid (PubChem CID 134725920) has the molecular formula C34H58O4 and a molecular weight of 530.83 g/mol. Its IUPAC name is 9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexadecanoic acid.
| Compound Name | 9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexadecanoic acid |
|---|---|
| PubChem CID | 134725920 |
| Molecular Formula | C34H58O4 |
| Molecular Weight | 530.83 g/mol |
| Exact Mass | 530.43 |
| IUPAC Name | 9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(CCCCCCC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C34H58O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-23-27-31-34(37)38-32(28-24-20-8-6-4-2)29-25-21-19-22-26-30-33(35)36/h5,7,10-11,13-14,16-17,32H,3-4,6,8-9,12,15,18-31H2,1-2H3,(H,35,36)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | DAIQHAYORSWRMX-ZRENGBSJSA-N |
| XLogP | 10.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.83 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|