C36H60O4 — CID 134729459
7-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyhexadecanoic acid (PubChem CID 134729459) has the molecular formula C36H60O4 and a molecular weight of 556.87 g/mol. Its IUPAC name is 7-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyhexadecanoic acid.
| Compound Name | 7-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyhexadecanoic acid |
|---|---|
| PubChem CID | 134729459 |
| Molecular Formula | C36H60O4 |
| Molecular Weight | 556.87 g/mol |
| Exact Mass | 556.45 |
| IUPAC Name | 7-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyhexadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(CCCCCCCCC)CCCCCC(=O)O |
| InChI | InChI=1S/C36H60O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-29-33-36(39)40-34(31-27-25-28-32-35(37)38)30-26-23-21-10-8-6-4-2/h5,7,11-12,14-15,17-18,20,22,34H,3-4,6,8-10,13,16,19,21,23-33H2,1-2H3,(H,37,38)/b7-5-,12-11-,15-14-,18-17-,22-20- |
| InChIKey | FGYZSDFIZIEMOP-YJXIRHGTSA-N |
| XLogP | 11.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.87 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|