C37H65O8P — CID 134742809
[(2R)-1-[(E)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate (PubChem CID 134742809) has the molecular formula C37H65O8P and a molecular weight of 668.89 g/mol. Its IUPAC name is [(2R)-1-[(E)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate.
| Compound Name | [(2R)-1-[(E)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 134742809 |
| Molecular Formula | C37H65O8P |
| Molecular Weight | 668.89 g/mol |
| Exact Mass | 668.44 |
| IUPAC Name | [(2R)-1-[(E)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C37H65O8P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-37(39)45-35(34-44-46(40,41)42)33-43-36(38)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h11,13-14,16-18,22,24,35H,3-10,12,15,19-21,23,25-34H2,1-2H3,(H2,40,41,42)/b13-11+,16-14+,18-17+,24-22+/t35-/m1/s1 |
| InChIKey | JYOCUILAZUIHCV-OKRAZMICSA-N |
| XLogP | 10.40 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.89 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|