C33H61O8P — CID 138291658
(1-decanoyloxy-3-phosphonooxypropan-2-yl) (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 138291658) has the molecular formula C33H61O8P and a molecular weight of 616.82 g/mol. Its IUPAC name is (1-decanoyloxy-3-phosphonooxypropan-2-yl) (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | (1-decanoyloxy-3-phosphonooxypropan-2-yl) (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 138291658 |
| Molecular Formula | C33H61O8P |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.41 |
| IUPAC Name | (1-decanoyloxy-3-phosphonooxypropan-2-yl) (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C33H61O8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-33(35)41-31(30-40-42(36,37)38)29-39-32(34)27-25-23-21-10-8-6-4-2/h11-12,14-15,31H,3-10,13,16-30H2,1-2H3,(H2,36,37,38)/b12-11-,15-14- |
| InChIKey | WTHZCSGRJOEQMR-HDXUUTQWSA-N |
| XLogP | 9.29 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|