C39H67O8P — CID 134780687
[(2R)-1-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate (PubChem CID 134780687) has the molecular formula C39H67O8P and a molecular weight of 694.93 g/mol. Its IUPAC name is [(2R)-1-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate.
| Compound Name | [(2R)-1-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate |
|---|---|
| PubChem CID | 134780687 |
| Molecular Formula | C39H67O8P |
| Molecular Weight | 694.93 g/mol |
| Exact Mass | 694.46 |
| IUPAC Name | [(2R)-1-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C39H67O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40)45-35-37(36-46-48(42,43)44)47-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,23-26,37H,3-10,12,14-16,21-22,27-36H2,1-2H3,(H2,42,43,44)/b13-11+,19-17+,20-18+,25-23+,26-24+/t37-/m1/s1 |
| InChIKey | YBVKCBYLPQTYRH-DRSSECIASA-N |
| XLogP | 10.95 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.93 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|