C45H81O8P — CID 52929207
[(2R)-1-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-docos-11-enoate (PubChem CID 52929207) has the molecular formula C45H81O8P and a molecular weight of 781.11 g/mol. Its IUPAC name is [(2R)-1-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-docos-11-enoate.
| Compound Name | [(2R)-1-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-docos-11-enoate |
|---|---|
| PubChem CID | 52929207 |
| Molecular Formula | C45H81O8P |
| Molecular Weight | 781.11 g/mol |
| Exact Mass | 780.57 |
| IUPAC Name | [(2R)-1-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-docos-11-enoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC/C=C\CCCCCCCCCC |
| InChI | InChI=1S/C45H81O8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-45(47)53-43(42-52-54(48,49)50)41-51-44(46)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h12,14,18,20-22,25,27,43H,3-11,13,15-17,19,23-24,26,28-42H2,1-2H3,(H2,48,49,50)/b14-12-,20-18-,22-21-,27-25-/t43-/m1/s1 |
| InChIKey | CYGZJWYYMNUWCJ-FMZVSRQTSA-N |
| XLogP | 13.52 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.11 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|