C43H76NO10P — CID 134743930
(2S)-2-amino-3-[[(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134743930) has the molecular formula C43H76NO10P and a molecular weight of 798.05 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134743930 |
| Molecular Formula | C43H76NO10P |
| Molecular Weight | 798.05 g/mol |
| Exact Mass | 797.52 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C43H76NO10P/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-42(46)54-39(37-52-55(49,50)53-38-40(44)43(47)48)36-51-41(45)34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h10-13,16-19,39-40H,3-9,14-15,20-38,44H2,1-2H3,(H,47,48)(H,49,50)/b12-10+,13-11+,18-16+,19-17+/t39-,40+/m1/s1 |
| InChIKey | KJAIOOVCZQKXQK-MONOVTDSSA-N |
| XLogP | 11.00 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.05 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|