C34H62NO10P — CID 134775430
(2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134775430) has the molecular formula C34H62NO10P and a molecular weight of 675.84 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134775430 |
| Molecular Formula | C34H62NO10P |
| Molecular Weight | 675.84 g/mol |
| Exact Mass | 675.41 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-undecanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C34H62NO10P/c1-3-5-7-9-11-13-14-15-16-17-18-20-22-24-26-33(37)45-30(28-43-46(40,41)44-29-31(35)34(38)39)27-42-32(36)25-23-21-19-12-10-8-6-4-2/h9,11,14-15,30-31H,3-8,10,12-13,16-29,35H2,1-2H3,(H,38,39)(H,40,41)/b11-9+,15-14+/t30-,31+/m1/s1 |
| InChIKey | WDPFKQZSVPUIPY-DLDGREDASA-N |
| XLogP | 7.94 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.84 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|