C31H56NO10P — CID 138171012
2-amino-3-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138171012) has the molecular formula C31H56NO10P and a molecular weight of 633.76 g/mol. Its IUPAC name is 2-amino-3-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138171012 |
| Molecular Formula | C31H56NO10P |
| Molecular Weight | 633.76 g/mol |
| Exact Mass | 633.36 |
| IUPAC Name | 2-amino-3-[[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-octanoyloxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C31H56NO10P/c1-3-5-7-9-10-11-12-13-14-15-16-17-19-21-23-30(34)42-27(24-39-29(33)22-20-18-8-6-4-2)25-40-43(37,38)41-26-28(32)31(35)36/h9-10,12-13,27-28H,3-8,11,14-26,32H2,1-2H3,(H,35,36)(H,37,38)/b10-9-,13-12- |
| InChIKey | HPMCLZDFBQEFEW-UTJQPWESSA-N |
| XLogP | 6.77 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|