C41H74NO10P — CID 134761421
(2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134761421) has the molecular formula C41H74NO10P and a molecular weight of 772.01 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134761421 |
| Molecular Formula | C41H74NO10P |
| Molecular Weight | 772.01 g/mol |
| Exact Mass | 771.51 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/CCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C41H74NO10P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-39(43)49-34-37(35-50-53(47,48)51-36-38(42)41(45)46)52-40(44)33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h10,12-13,15-16,18,37-38H,3-9,11,14,17,19-36,42H2,1-2H3,(H,45,46)(H,47,48)/b12-10+,15-13+,18-16+/t37-,38+/m1/s1 |
| InChIKey | QMNMHZRXBYTXCJ-QQESSTATSA-N |
| XLogP | 10.45 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.01 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|