C32H56O4 — CID 134754907
6-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxytetradecanoic acid (PubChem CID 134754907) has the molecular formula C32H56O4 and a molecular weight of 504.80 g/mol. Its IUPAC name is 6-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxytetradecanoic acid.
| Compound Name | 6-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxytetradecanoic acid |
|---|---|
| PubChem CID | 134754907 |
| Molecular Formula | C32H56O4 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.42 |
| IUPAC Name | 6-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxytetradecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CCCCCCCC)CCCCC(=O)O |
| InChI | InChI=1S/C32H56O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-23-29-32(35)36-30(27-24-25-28-31(33)34)26-22-20-10-8-6-4-2/h5,7,11-12,14-15,30H,3-4,6,8-10,13,16-29H2,1-2H3,(H,33,34)/b7-5-,12-11-,15-14- |
| InChIKey | OFNXMXFTWKZDSU-BBDKIWCZSA-N |
| XLogP | 9.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|