C38H60O5 — CID 134758319
[1-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-hydroxypropan-2-yl] (4E,7E,10E,13E,16E)-nonadeca-4,7,10,13,16-pentaenoate (PubChem CID 134758319) has the molecular formula C38H60O5 and a molecular weight of 596.89 g/mol. Its IUPAC name is [1-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-hydroxypropan-2-yl] (4E,7E,10E,13E,16E)-nonadeca-4,7,10,13,16-pentaenoate.
| Compound Name | [1-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-hydroxypropan-2-yl] (4E,7E,10E,13E,16E)-nonadeca-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 134758319 |
| Molecular Formula | C38H60O5 |
| Molecular Weight | 596.89 g/mol |
| Exact Mass | 596.44 |
| IUPAC Name | [1-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-hydroxypropan-2-yl] (4E,7E,10E,13E,16E)-nonadeca-4,7,10,13,16-pentaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)OC(CO)COC(=O)CC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C38H60O5/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-38(41)43-36(34-39)35-42-37(40)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h5,7,11,13,17-18,20-23,26-29,36,39H,3-4,6,8-10,12,14-16,19,24-25,30-35H2,1-2H3/b7-5+,13-11+,18-17+,22-20+,23-21+,28-26+,29-27+ |
| InChIKey | PKTHUVQDRHGKMO-JNLGTQHESA-N |
| XLogP | 10.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.89 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|