About ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate
ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate (PubChem CID 13477514) has the molecular formula C13H17Cl3O2
and a molecular weight of 311.64 g/mol. Its IUPAC name is ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate |
| PubChem CID | 13477514 |
| Molecular Formula | C13H17Cl3O2 |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate |
| SMILES | CCOC(=O)C1C(C(Cl)=C(Cl)Cl)C12CCCCC2 |
| InChI | InChI=1S/C13H17Cl3O2/c1-2-18-12(17)9-8(10(14)11(15)16)13(9)6-4-3-5-7-13/h8-9H,2-7H2,1H3 |
| InChIKey | UUUSHISZSVHDBH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate?
The IUPAC name of ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate (CID 13477514) is ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate.
What is the SMILES notation for ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate?
The canonical SMILES for ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate is CCOC(=O)C1C(C(Cl)=C(Cl)Cl)C12CCCCC2.
What is the InChIKey of ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate?
The InChIKey is UUUSHISZSVHDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl3O2/c1-2-18-12(17)9-8(10(14)11(15)16)13(9)6-4-3-5-7-13/h8-9H,2-7H2,1H3.
What are the key properties of ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate?
ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate has a molecular weight of 311.64 g/mol, XLogP of 4.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(1,2,2-trichloroethenyl)spiro[2.5]octane-2-carboxylate is sourced from PubChem (CID 13477514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).