C17H18N2O4S2 — CID 134794368
CID 134794368 (PubChem CID 134794368) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol.
| Compound Name | CID 134794368 |
|---|---|
| PubChem CID | 134794368 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | — |
| SMILES | O=C1NC2(CCCN([S+](=O)([O-])c3ccsc3)C2)COc2ccccc21 |
| InChI | InChI=1S/C17H18N2O4S2/c20-16-14-4-1-2-5-15(14)23-12-17(18-16)7-3-8-19(11-17)25(21,22)13-6-9-24-10-13/h1-2,4-6,9-10H,3,7-8,11-12H2,(H-,18,20,21,22) |
| InChIKey | JJCZJRAHKBKJAM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|