C27H32N6O — CID 134795876
(4-benzylpiperazin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone (PubChem CID 134795876) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 134795876 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone |
| SMILES | Cc1ccc(Nc2ccnc(N3CCCC3C(=O)N3CCN(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C27H32N6O/c1-21-9-11-23(12-10-21)29-25-13-14-28-27(30-25)33-15-5-8-24(33)26(34)32-18-16-31(17-19-32)20-22-6-3-2-4-7-22/h2-4,6-7,9-14,24H,5,8,15-20H2,1H3,(H,28,29,30) |
| InChIKey | SWHFLEGSJPOWNG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |