C28H33N5O — CID 134797340
(4-benzylpiperidin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone (PubChem CID 134797340) has the molecular formula C28H33N5O and a molecular weight of 455.61 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 134797340 |
| Molecular Formula | C28H33N5O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-[4-(4-methylanilino)pyrimidin-2-yl]pyrrolidin-2-yl]methanone |
| SMILES | Cc1ccc(Nc2ccnc(N3CCCC3C(=O)N3CCC(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C28H33N5O/c1-21-9-11-24(12-10-21)30-26-13-16-29-28(31-26)33-17-5-8-25(33)27(34)32-18-14-23(15-19-32)20-22-6-3-2-4-7-22/h2-4,6-7,9-13,16,23,25H,5,8,14-15,17-20H2,1H3,(H,29,30,31) |
| InChIKey | XPEYOFMIRXKEHX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |