C22H25N5O3S — CID 134799766
CID 134799766 (PubChem CID 134799766) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol.
| Compound Name | CID 134799766 |
|---|---|
| PubChem CID | 134799766 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | — |
| SMILES | O=C(C1CCN([S+](=O)([O-])c2ccccc2)C1)N1CCC(c2nc3ncccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H25N5O3S/c28-22(17-10-14-27(15-17)31(29,30)18-5-2-1-3-6-18)26-12-8-16(9-13-26)20-24-19-7-4-11-23-21(19)25-20/h1-7,11,16-17H,8-10,12-15H2,(H-,23,24,25,29,30) |
| InChIKey | FZSKYGRSOZJISB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|