C23H23N5O4 — CID 134805168
2-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone (PubChem CID 134805168) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone |
|---|---|
| PubChem CID | 134805168 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyanilino)-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl]ethanone |
| SMILES | COc1ccccc1Nc1ncc2c(n1)CN(C(=O)Cc1ccc3c(c1)OCO3)CCN2 |
| InChI | InChI=1S/C23H23N5O4/c1-30-19-5-3-2-4-16(19)26-23-25-12-17-18(27-23)13-28(9-8-24-17)22(29)11-15-6-7-20-21(10-15)32-14-31-20/h2-7,10,12,24H,8-9,11,13-14H2,1H3,(H,25,26,27) |
| InChIKey | OLTVTCWBZMSELG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |