C23H22N6O — CID 134805534
(2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(1-methylindol-2-yl)methanone (PubChem CID 134805534) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is (2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(1-methylindol-2-yl)methanone.
| Compound Name | (2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(1-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 134805534 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(1-methylindol-2-yl)methanone |
| SMILES | Cn1c(C(=O)N2CCNc3cnc(Nc4ccccc4)nc3C2)cc2ccccc21 |
| InChI | InChI=1S/C23H22N6O/c1-28-20-10-6-5-7-16(20)13-21(28)22(30)29-12-11-24-18-14-25-23(27-19(18)15-29)26-17-8-3-2-4-9-17/h2-10,13-14,24H,11-12,15H2,1H3,(H,25,26,27) |
| InChIKey | FGFQZUPCXAABNR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |