C18H19N7O — CID 134809237
(2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(2-methylpyrazol-3-yl)methanone (PubChem CID 134809237) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is (2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(2-methylpyrazol-3-yl)methanone.
| Compound Name | (2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 134809237 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2-anilino-5,6,7,9-tetrahydropyrimido[5,4-e][1,4]diazepin-8-yl)-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1CCNc2cnc(Nc3ccccc3)nc2C1 |
| InChI | InChI=1S/C18H19N7O/c1-24-16(7-8-21-24)17(26)25-10-9-19-14-11-20-18(23-15(14)12-25)22-13-5-3-2-4-6-13/h2-8,11,19H,9-10,12H2,1H3,(H,20,22,23) |
| InChIKey | HBPDXGPPWNBEAX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |