C25H25N3O4 — CID 134807351
5-[2-(4-hydroxyphenyl)acetyl]-N-(2-phenoxyethyl)-7,8-dihydro-6H-1,5-naphthyridine-3-carboxamide (PubChem CID 134807351) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)acetyl]-N-(2-phenoxyethyl)-7,8-dihydro-6H-1,5-naphthyridine-3-carboxamide.
| Compound Name | 5-[2-(4-hydroxyphenyl)acetyl]-N-(2-phenoxyethyl)-7,8-dihydro-6H-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134807351 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)acetyl]-N-(2-phenoxyethyl)-7,8-dihydro-6H-1,5-naphthyridine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc2c(c1)N(C(=O)Cc1ccc(O)cc1)CCC2 |
| InChI | InChI=1S/C25H25N3O4/c29-20-10-8-18(9-11-20)15-24(30)28-13-4-7-22-23(28)16-19(17-27-22)25(31)26-12-14-32-21-5-2-1-3-6-21/h1-3,5-6,8-11,16-17,29H,4,7,12-15H2,(H,26,31) |
| InChIKey | ZMCCVZPYCGWIQH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|