C19H15N5O — CID 134808694
3-benzyl-6-(pyridin-3-ylamino)pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134808694) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-benzyl-6-(pyridin-3-ylamino)pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-6-(pyridin-3-ylamino)pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 134808694 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-benzyl-6-(pyridin-3-ylamino)pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2nc(Nc3cccnc3)ccc2ncn1Cc1ccccc1 |
| InChI | InChI=1S/C19H15N5O/c25-19-18-16(21-13-24(19)12-14-5-2-1-3-6-14)8-9-17(23-18)22-15-7-4-10-20-11-15/h1-11,13H,12H2,(H,22,23) |
| InChIKey | ZMLNKAVTOKAUAE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |