C22H20N4O2 — CID 134805271
1-benzyl-6-(2-phenoxyethylamino)pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134805271) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-benzyl-6-(2-phenoxyethylamino)pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 1-benzyl-6-(2-phenoxyethylamino)pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 134805271 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-benzyl-6-(2-phenoxyethylamino)pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1ncn(Cc2ccccc2)c2ccc(NCCOc3ccccc3)nc12 |
| InChI | InChI=1S/C22H20N4O2/c27-22-21-19(26(16-24-22)15-17-7-3-1-4-8-17)11-12-20(25-21)23-13-14-28-18-9-5-2-6-10-18/h1-12,16H,13-15H2,(H,23,25) |
| InChIKey | UBFNORDXACPUTG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|