C17H10F6N2OS — CID 134815437
3-[3-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 134815437) has the molecular formula C17H10F6N2OS and a molecular weight of 404.34 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 134815437 |
| Molecular Formula | C17H10F6N2OS |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2cccc(C(F)(F)F)c2)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F6N2OS/c18-16(19,20)10-3-1-5-12(7-10)24-15-25(14(26)9-27-15)13-6-2-4-11(8-13)17(21,22)23/h1-8H,9H2/b24-15- |
| InChIKey | ITBUFBBPAPYBKP-IWIPYMOSSA-N |
| XLogP | 5.49 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|