C18H16N6O3S — CID 134815518
3,5-diamino-1-[2-(4-nitrophenyl)acetyl]-N-phenylpyrazole-4-carbothioamide (PubChem CID 134815518) has the molecular formula C18H16N6O3S and a molecular weight of 396.43 g/mol. Its IUPAC name is 3,5-diamino-1-[2-(4-nitrophenyl)acetyl]-N-phenylpyrazole-4-carbothioamide.
| Compound Name | 3,5-diamino-1-[2-(4-nitrophenyl)acetyl]-N-phenylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 134815518 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3,5-diamino-1-[2-(4-nitrophenyl)acetyl]-N-phenylpyrazole-4-carbothioamide |
| SMILES | Nc1nn(C(=O)Cc2ccc([N+](=O)[O-])cc2)c(N)c1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H16N6O3S/c19-16-15(18(28)21-12-4-2-1-3-5-12)17(20)23(22-16)14(25)10-11-6-8-13(9-7-11)24(26)27/h1-9H,10,20H2,(H2,19,22)(H,21,28) |
| InChIKey | SJHHQXKWXMUKAA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|