About 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide
1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide (PubChem CID 5106450) has the molecular formula C24H21N3O2S
and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide.
Molecular Properties
| Compound Name | 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide |
| PubChem CID | 5106450 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(CN2CCC(C(=S)Nc3ccccc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O2S/c28-27(29)21-13-11-18(12-14-21)17-26-16-15-22(23(26)19-7-3-1-4-8-19)24(30)25-20-9-5-2-6-10-20/h1-14H,15-17H2,(H,25,30) |
| InChIKey | BRKZANBDFQCSJO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide?
The IUPAC name of 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide (CID 5106450) is 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide.
What is the SMILES notation for 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide?
The canonical SMILES for 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide is O=[N+]([O-])c1ccc(CN2CCC(C(=S)Nc3ccccc3)=C2c2ccccc2)cc1.
What is the InChIKey of 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide?
The InChIKey is BRKZANBDFQCSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O2S/c28-27(29)21-13-11-18(12-14-21)17-26-16-15-22(23(26)19-7-3-1-4-8-19)24(30)25-20-9-5-2-6-10-20/h1-14H,15-17H2,(H,25,30).
What are the key properties of 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide?
1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide has a molecular weight of 415.52 g/mol, XLogP of 5.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-nitrophenyl)methyl]-N,5-diphenyl-2,3-dihydropyrrole-4-carbothioamide is sourced from PubChem (CID 5106450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).