C23H31NO3 — CID 134816774
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-[(1R,2R,3R,5S)-2,3,4,4,5-pentamethylcyclohexyl]penta-2,4-dienamide (PubChem CID 134816774) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-[(1R,2R,3R,5S)-2,3,4,4,5-pentamethylcyclohexyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-[(1R,2R,3R,5S)-2,3,4,4,5-pentamethylcyclohexyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 134816774 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-[(1R,2R,3R,5S)-2,3,4,4,5-pentamethylcyclohexyl]penta-2,4-dienamide |
| SMILES | C[C@@H]1[C@@H](C)C(C)(C)[C@@H](C)C[C@H]1NC(=O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H31NO3/c1-15-12-19(16(2)17(3)23(15,4)5)24-22(25)9-7-6-8-18-10-11-20-21(13-18)27-14-26-20/h6-11,13,15-17,19H,12,14H2,1-5H3,(H,24,25)/b8-6+,9-7+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | IKTZMLBITMUFBQ-RWAVZVRPSA-N |
| XLogP | 4.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|