C12H18N6O2S — CID 134820921
4-amino-2-[(3S)-3-(3-sulfanylpropanoylamino)pyrrolidin-1-yl]pyrimidine-5-carboxamide (PubChem CID 134820921) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-amino-2-[(3S)-3-(3-sulfanylpropanoylamino)pyrrolidin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-[(3S)-3-(3-sulfanylpropanoylamino)pyrrolidin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134820921 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-amino-2-[(3S)-3-(3-sulfanylpropanoylamino)pyrrolidin-1-yl]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(N2CC[C@H](NC(=O)CCS)C2)nc1N |
| InChI | InChI=1S/C12H18N6O2S/c13-10-8(11(14)20)5-15-12(17-10)18-3-1-7(6-18)16-9(19)2-4-21/h5,7,21H,1-4,6H2,(H2,14,20)(H,16,19)(H2,13,15,17)/t7-/m0/s1 |
| InChIKey | FGVUXHUVSOCKQS-ZETCQYMHSA-N |
| XLogP | -0.83 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|