C15H16N6O4 — CID 174240263
2,3-dioxo-5-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide (PubChem CID 174240263) has the molecular formula C15H16N6O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2,3-dioxo-5-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide.
| Compound Name | 2,3-dioxo-5-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 174240263 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2,3-dioxo-5-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,4-dihydropyrido[3,4-b]pyrazine-8-carboxamide |
| SMILES | C=CC(=O)NC1CCN(c2ncc(C(N)=O)c3[nH]c(=O)c(=O)[nH]c23)C1 |
| InChI | InChI=1S/C15H16N6O4/c1-2-9(22)18-7-3-4-21(6-7)13-11-10(8(5-17-13)12(16)23)19-14(24)15(25)20-11/h2,5,7H,1,3-4,6H2,(H2,16,23)(H,18,22)(H,19,24)(H,20,25) |
| InChIKey | PUTRXPCFUSQFQX-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|