C7H8O3 — CID 134823980
(2S)-4-methyl-6-oxo-2,3-dihydropyran-2-carbaldehyde (PubChem CID 134823980) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (2S)-4-methyl-6-oxo-2,3-dihydropyran-2-carbaldehyde.
| Compound Name | (2S)-4-methyl-6-oxo-2,3-dihydropyran-2-carbaldehyde |
|---|---|
| PubChem CID | 134823980 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (2S)-4-methyl-6-oxo-2,3-dihydropyran-2-carbaldehyde |
| SMILES | CC1=CC(=O)O[C@H](C=O)C1 |
| InChI | InChI=1S/C7H8O3/c1-5-2-6(4-8)10-7(9)3-5/h3-4,6H,2H2,1H3/t6-/m0/s1 |
| InChIKey | WMYMPMYDJIBWMH-LURJTMIESA-N |
| XLogP | 0.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|