C17H24O4 — CID 50916013
[(6E,10E)-2,6,10-trimethyl-5,12-dioxododeca-2,6,10-trien-4-yl] acetate (PubChem CID 50916013) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(6E,10E)-2,6,10-trimethyl-5,12-dioxododeca-2,6,10-trien-4-yl] acetate.
| Compound Name | [(6E,10E)-2,6,10-trimethyl-5,12-dioxododeca-2,6,10-trien-4-yl] acetate |
|---|---|
| PubChem CID | 50916013 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(6E,10E)-2,6,10-trimethyl-5,12-dioxododeca-2,6,10-trien-4-yl] acetate |
| SMILES | CC(=O)OC(C=C(C)C)C(=O)/C(C)=C/CC/C(C)=C/C=O |
| InChI | InChI=1S/C17H24O4/c1-12(2)11-16(21-15(5)19)17(20)14(4)8-6-7-13(3)9-10-18/h8-11,16H,6-7H2,1-5H3/b13-9+,14-8+ |
| InChIKey | KBPCHQYDLCOCCC-UAUIHIKDSA-N |
| XLogP | 3.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|