C23H32O9 — CID 162877691
[(2Z,5R,6E,9R,10E)-5,9-diacetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate (PubChem CID 162877691) has the molecular formula C23H32O9 and a molecular weight of 452.50 g/mol. Its IUPAC name is [(2Z,5R,6E,9R,10E)-5,9-diacetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate.
| Compound Name | [(2Z,5R,6E,9R,10E)-5,9-diacetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 162877691 |
| Molecular Formula | C23H32O9 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [(2Z,5R,6E,9R,10E)-5,9-diacetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\COC(C)=O)C[C@H](/C=C(\C)C[C@H](/C=C(\C)C=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C23H32O9/c1-15(9-22(31-19(5)27)11-16(2)13-24)10-23(32-20(6)28)12-21(14-30-18(4)26)7-8-29-17(3)25/h7,10-11,13,22-23H,8-9,12,14H2,1-6H3/b15-10+,16-11+,21-7-/t22-,23+/m1/s1 |
| InChIKey | CPTQKVROSNDWKU-BJAQUTAWSA-N |
| XLogP | 2.77 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|